C13H24N4O — CID 107206591
N-(5-aminopentyl)-N,1,3,5-tetramethylpyrazole-4-carboxamide (PubChem CID 107206591) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(5-aminopentyl)-N,1,3,5-tetramethylpyrazole-4-carboxamide.
| Compound Name | N-(5-aminopentyl)-N,1,3,5-tetramethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107206591 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-(5-aminopentyl)-N,1,3,5-tetramethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)N(C)CCCCCN |
| InChI | InChI=1S/C13H24N4O/c1-10-12(11(2)17(4)15-10)13(18)16(3)9-7-5-6-8-14/h5-9,14H2,1-4H3 |
| InChIKey | USQOOGVXGBNSRK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|