About N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine
N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine (PubChem CID 107206962) has the molecular formula C14H22N4S
and a molecular weight of 278.42 g/mol. Its IUPAC name is N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine |
| PubChem CID | 107206962 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine |
| SMILES | CCc1cc2c(N(C)CCCCCN)ncnc2s1 |
| InChI | InChI=1S/C14H22N4S/c1-3-11-9-12-13(16-10-17-14(12)19-11)18(2)8-6-4-5-7-15/h9-10H,3-8,15H2,1-2H3 |
| InChIKey | WMVXLYMZPAJUNN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine?
The IUPAC name of N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine (CID 107206962) is N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine.
What is the SMILES notation for N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine?
The canonical SMILES for N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine is CCc1cc2c(N(C)CCCCCN)ncnc2s1.
What is the InChIKey of N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine?
The InChIKey is WMVXLYMZPAJUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4S/c1-3-11-9-12-13(16-10-17-14(12)19-11)18(2)8-6-4-5-7-15/h9-10H,3-8,15H2,1-2H3.
What are the key properties of N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine?
N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine has a molecular weight of 278.42 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N'-methylpentane-1,5-diamine is sourced from PubChem (CID 107206962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).