About 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol
5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol (PubChem CID 107207671) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol |
| PubChem CID | 107207671 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1nnc(N)o1 |
| InChI | InChI=1S/C8H16N4O2/c1-12(5-3-2-4-6-13)8-11-10-7(9)14-8/h13H,2-6H2,1H3,(H2,9,10) |
| InChIKey | VEUVXVQPTYJJHO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol?
The IUPAC name of 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol (CID 107207671) is 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol.
What is the SMILES notation for 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol?
The canonical SMILES for 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol is CN(CCCCCO)c1nnc(N)o1.
What is the InChIKey of 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol?
The InChIKey is VEUVXVQPTYJJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2/c1-12(5-3-2-4-6-13)8-11-10-7(9)14-8/h13H,2-6H2,1H3,(H2,9,10).
What are the key properties of 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol?
5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol has a molecular weight of 200.24 g/mol, XLogP of 0.25, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-1,3,4-oxadiazol-2-yl)-methylamino]pentan-1-ol is sourced from PubChem (CID 107207671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).