C15H22N2O4 — CID 107207865
3-[(4-amino-2-methoxybenzoyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 107207865) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[(4-amino-2-methoxybenzoyl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(4-amino-2-methoxybenzoyl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 107207865 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-[(4-amino-2-methoxybenzoyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | COc1cc(N)ccc1C(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H22N2O4/c1-14(2,13(19)20)15(3,4)17-12(18)10-7-6-9(16)8-11(10)21-5/h6-8H,16H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | HRDDVPVGVUITAX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|