C32H28O7 — CID 10720850
[(2R,3R,4R)-8-methoxy-3-methyl-1,7,12-trioxo-2-[(2R)-2-phenylbutanoyl]-3,4-dihydro-2H-benzo[a]anthracen-4-yl] acetate (PubChem CID 10720850) has the molecular formula C32H28O7 and a molecular weight of 524.57 g/mol. Its IUPAC name is [(2R,3R,4R)-8-methoxy-3-methyl-1,7,12-trioxo-2-[(2R)-2-phenylbutanoyl]-3,4-dihydro-2H-benzo[a]anthracen-4-yl] acetate.
| Compound Name | [(2R,3R,4R)-8-methoxy-3-methyl-1,7,12-trioxo-2-[(2R)-2-phenylbutanoyl]-3,4-dihydro-2H-benzo[a]anthracen-4-yl] acetate |
|---|---|
| PubChem CID | 10720850 |
| Molecular Formula | C32H28O7 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | [(2R,3R,4R)-8-methoxy-3-methyl-1,7,12-trioxo-2-[(2R)-2-phenylbutanoyl]-3,4-dihydro-2H-benzo[a]anthracen-4-yl] acetate |
| SMILES | CC[C@@H](C(=O)[C@@H]1C(=O)c2c(ccc3c2C(=O)c2cccc(OC)c2C3=O)[C@H](OC(C)=O)[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C32H28O7/c1-5-19(18-10-7-6-8-11-18)28(34)24-16(2)32(39-17(3)33)22-15-14-21-26(27(22)31(24)37)30(36)20-12-9-13-23(38-4)25(20)29(21)35/h6-16,19,24,32H,5H2,1-4H3/t16-,19-,24-,32-/m1/s1 |
| InChIKey | ZIYXENJPTSOOAW-BTCLXEOMSA-N |
| XLogP | 5.29 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|