C15H19N3O3 — CID 107209258
3-methoxy-4-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 107209258) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-methoxy-4-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-methoxy-4-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 107209258 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-methoxy-4-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | COc1cc(N)ccc1-c1nc(C2(C)CCCCO2)no1 |
| InChI | InChI=1S/C15H19N3O3/c1-15(7-3-4-8-20-15)14-17-13(21-18-14)11-6-5-10(16)9-12(11)19-2/h5-6,9H,3-4,7-8,16H2,1-2H3 |
| InChIKey | APJYRPJMDZLJMG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|