C24H22BrClN4O3 — CID 10720963
(1-oxidopyridin-1-ium-3-yl) 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate (PubChem CID 10720963) has the molecular formula C24H22BrClN4O3 and a molecular weight of 529.82 g/mol. Its IUPAC name is (1-oxidopyridin-1-ium-3-yl) 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate.
| Compound Name | (1-oxidopyridin-1-ium-3-yl) 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10720963 |
| Molecular Formula | C24H22BrClN4O3 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | (1-oxidopyridin-1-ium-3-yl) 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc[n+]([O-])c1)N1CCN(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CC1 |
| InChI | InChI=1S/C24H22BrClN4O3/c25-18-12-17-4-3-16-13-19(26)5-6-21(16)23(22(17)27-14-18)28-8-10-29(11-9-28)24(31)33-20-2-1-7-30(32)15-20/h1-2,5-7,12-15,23H,3-4,8-11H2 |
| InChIKey | PZDLWSGRQNLKCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|