C25H12F4O9 — CID 10721007
3',6'-diacetyloxy-2',4',5',7'-tetrafluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (PubChem CID 10721007) has the molecular formula C25H12F4O9 and a molecular weight of 532.35 g/mol. Its IUPAC name is 3',6'-diacetyloxy-2',4',5',7'-tetrafluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid.
| Compound Name | 3',6'-diacetyloxy-2',4',5',7'-tetrafluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
|---|---|
| PubChem CID | 10721007 |
| Molecular Formula | C25H12F4O9 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 3',6'-diacetyloxy-2',4',5',7'-tetrafluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| SMILES | CC(=O)Oc1c(F)cc2c(c1F)Oc1c(cc(F)c(OC(C)=O)c1F)C21OC(=O)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C25H12F4O9/c1-8(30)35-21-15(26)6-13-19(17(21)28)37-20-14(7-16(27)22(18(20)29)36-9(2)31)25(13)12-4-3-10(23(32)33)5-11(12)24(34)38-25/h3-7H,1-2H3,(H,32,33) |
| InChIKey | OWDLWXGKVFYBQF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|