C13H17N3O3 — CID 107211873
N-(2-aminoethyl)-N'-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide (PubChem CID 107211873) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide |
|---|---|
| PubChem CID | 107211873 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2-aminoethyl)-N'-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide |
| SMILES | NCCNC(=O)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C13H17N3O3/c14-5-6-15-12(18)13(19)16-11-9-4-2-1-3-8(9)7-10(11)17/h1-4,10-11,17H,5-7,14H2,(H,15,18)(H,16,19)/t10-,11+/m1/s1 |
| InChIKey | UNLBIJRGDDKYKG-MNOVXSKESA-N |
| XLogP | -1.16 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|