C13H18N2O3S — CID 107212621
1-[(4-aminophenyl)methylsulfonyl]-3-cyclopropylazetidin-3-ol (PubChem CID 107212621) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methylsulfonyl]-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-[(4-aminophenyl)methylsulfonyl]-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 107212621 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[(4-aminophenyl)methylsulfonyl]-3-cyclopropylazetidin-3-ol |
| SMILES | Nc1ccc(CS(=O)(=O)N2CC(O)(C3CC3)C2)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c14-12-5-1-10(2-6-12)7-19(17,18)15-8-13(16,9-15)11-3-4-11/h1-2,5-6,11,16H,3-4,7-9,14H2 |
| InChIKey | UALAHZKRTWOCLW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|