About bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc
bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc (PubChem CID 10721329) has the molecular formula C30H28O6Zn
and a molecular weight of 549.94 g/mol. Its IUPAC name is bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc.
Molecular Properties
| Compound Name | bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc |
| PubChem CID | 10721329 |
| Molecular Formula | C30H28O6Zn |
| Molecular Weight | 549.94 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc |
| SMILES | CC(C)=CCC1=C(O)c2ccccc2C(=O)C1=O.CC(C)=CCC1=C(O)c2ccccc2C(=O)C1=O.[Zn] |
| InChI | InChI=1S/2C15H14O3.Zn/c2*1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18;/h2*3-7,16H,8H2,1-2H3; |
| InChIKey | BQXUEBGCCXZHLG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.94 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc?
The IUPAC name of bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc (CID 10721329) is bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc.
What is the SMILES notation for bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc?
The canonical SMILES for bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc is CC(C)=CCC1=C(O)c2ccccc2C(=O)C1=O.CC(C)=CCC1=C(O)c2ccccc2C(=O)C1=O.[Zn].
What is the InChIKey of bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc?
The InChIKey is BQXUEBGCCXZHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H14O3.Zn/c2*1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18;/h2*3-7,16H,8H2,1-2H3;.
What are the key properties of bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc?
bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc has a molecular weight of 549.94 g/mol, XLogP of 6.15, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione);zinc is sourced from PubChem (CID 10721329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).