About 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol
2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107214045) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol |
| PubChem CID | 107214045 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | Cc1cc(C)c(CN)c(N2CCCN(CCO)CC2)n1 |
| InChI | InChI=1S/C15H26N4O/c1-12-10-13(2)17-15(14(12)11-16)19-5-3-4-18(6-7-19)8-9-20/h10,20H,3-9,11,16H2,1-2H3 |
| InChIKey | COPJPGOYQACMSY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol?
The IUPAC name of 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol (CID 107214045) is 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol.
What is the SMILES notation for 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol?
The canonical SMILES for 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol is Cc1cc(C)c(CN)c(N2CCCN(CCO)CC2)n1.
What is the InChIKey of 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol?
The InChIKey is COPJPGOYQACMSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O/c1-12-10-13(2)17-15(14(12)11-16)19-5-3-4-18(6-7-19)8-9-20/h10,20H,3-9,11,16H2,1-2H3.
What are the key properties of 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol?
2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol has a molecular weight of 278.40 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(aminomethyl)-4,6-dimethyl-2-pyridinyl]-1,4-diazepan-1-yl]ethanol is sourced from PubChem (CID 107214045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).