C10H13NO5S2 — CID 107215064
4-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonyl-5-methylthiophene-2-carboxylic acid (PubChem CID 107215064) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonyl-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonyl-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107215064 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 4-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonyl-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H13NO5S2/c1-6-9(4-8(17-6)10(13)14)18(15,16)11-3-2-7(12)5-11/h4,7,12H,2-3,5H2,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | DQKLMNOOFOZLFQ-SSDOTTSWSA-N |
| XLogP | 0.51 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |