C37H49NO3 — CID 10721521
N-[(E,2S,3R)-3-hydroxy-1-trityloxydodec-4-en-2-yl]hexanamide (PubChem CID 10721521) has the molecular formula C37H49NO3 and a molecular weight of 555.80 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-hydroxy-1-trityloxydodec-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3R)-3-hydroxy-1-trityloxydodec-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10721521 |
| Molecular Formula | C37H49NO3 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.37 |
| IUPAC Name | N-[(E,2S,3R)-3-hydroxy-1-trityloxydodec-4-en-2-yl]hexanamide |
| SMILES | CCCCCCC/C=C/[C@@H](O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCCCC |
| InChI | InChI=1S/C37H49NO3/c1-3-5-7-8-9-10-21-28-35(39)34(38-36(40)29-14-6-4-2)30-41-37(31-22-15-11-16-23-31,32-24-17-12-18-25-32)33-26-19-13-20-27-33/h11-13,15-28,34-35,39H,3-10,14,29-30H2,1-2H3,(H,38,40)/b28-21+/t34-,35+/m0/s1 |
| InChIKey | FCMFHQKQLXUAAC-UWALDQPUSA-N |
| XLogP | 8.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|