About 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid
4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid (PubChem CID 107216292) has the molecular formula C11H17N3O5S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
| PubChem CID | 107216292 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1[nH]nc(C(=O)O)c1S(=O)(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H17N3O5S/c1-6-10(9(11(16)17)13-12-6)20(18,19)14-7-4-2-3-5-8(7)15/h7-8,14-15H,2-5H2,1H3,(H,12,13)(H,16,17)/t7-,8-/m1/s1 |
| InChIKey | PFWTYJHPIVNYTF-HTQZYQBOSA-N |
| XLogP | -0.00 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid?
The IUPAC name of 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid (CID 107216292) is 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid.
What is the SMILES notation for 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid?
The canonical SMILES for 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid is Cc1[nH]nc(C(=O)O)c1S(=O)(=O)N[C@@H]1CCCC[C@H]1O.
What is the InChIKey of 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid?
The InChIKey is PFWTYJHPIVNYTF-HTQZYQBOSA-N. The full InChI is InChI=1S/C11H17N3O5S/c1-6-10(9(11(16)17)13-12-6)20(18,19)14-7-4-2-3-5-8(7)15/h7-8,14-15H,2-5H2,1H3,(H,12,13)(H,16,17)/t7-,8-/m1/s1.
What are the key properties of 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid?
4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid has a molecular weight of 303.34 g/mol, XLogP of -0.00, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid is sourced from PubChem (CID 107216292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).