C29H23ClN2O6S — CID 10721639
4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate (PubChem CID 10721639) has the molecular formula C29H23ClN2O6S and a molecular weight of 563.03 g/mol. Its IUPAC name is 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate.
| Compound Name | 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10721639 |
| Molecular Formula | C29H23ClN2O6S |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate |
| SMILES | NS(=O)(=O)c1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H23N2O2S.ClHO4/c30-34(32,33)27-18-16-26(17-19-27)31-28(23-12-6-2-7-13-23)20-25(22-10-4-1-5-11-22)21-29(31)24-14-8-3-9-15-24;2-1(3,4)5/h1-21H,(H2,30,32,33);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XIFDALVNAPTWTQ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|