C17H16ClNO2 — CID 107216797
3-(chloromethyl)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 107216797) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 3-(chloromethyl)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 3-(chloromethyl)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 107216797 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-(chloromethyl)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | O=C(N[C@@H]1c2ccccc2C[C@@H]1O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C17H16ClNO2/c18-10-11-4-3-6-13(8-11)17(21)19-16-14-7-2-1-5-12(14)9-15(16)20/h1-8,15-16,20H,9-10H2,(H,19,21)/t15-,16+/m0/s1 |
| InChIKey | SKHWKPWQCUUSLS-JKSUJKDBSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|