C31H37N3O5 — CID 10721720
[3-[[methyl-[3-(5-oxochromeno[2,3-b]pyridin-8-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate (PubChem CID 10721720) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is [3-[[methyl-[3-(5-oxochromeno[2,3-b]pyridin-8-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate.
| Compound Name | [3-[[methyl-[3-(5-oxochromeno[2,3-b]pyridin-8-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
|---|---|
| PubChem CID | 10721720 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [3-[[methyl-[3-(5-oxochromeno[2,3-b]pyridin-8-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)c4cccnc4oc3c2)c1 |
| InChI | InChI=1S/C31H37N3O5/c1-3-4-5-6-7-16-33-31(36)38-25-12-8-11-23(20-25)22-34(2)18-10-19-37-24-14-15-26-28(21-24)39-30-27(29(26)35)13-9-17-32-30/h8-9,11-15,17,20-21H,3-7,10,16,18-19,22H2,1-2H3,(H,33,36) |
| InChIKey | YMUNYIHDWCEAKU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|