C9H16N2O4 — CID 107217271
ethyl 2-amino-3-[(3R)-3-hydroxypyrrolidin-1-yl]-3-oxopropanoate (PubChem CID 107217271) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is ethyl 2-amino-3-[(3R)-3-hydroxypyrrolidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[(3R)-3-hydroxypyrrolidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 107217271 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | ethyl 2-amino-3-[(3R)-3-hydroxypyrrolidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C9H16N2O4/c1-2-15-9(14)7(10)8(13)11-4-3-6(12)5-11/h6-7,12H,2-5,10H2,1H3/t6-,7?/m1/s1 |
| InChIKey | SZAVDZPDYJFLRE-ULUSZKPHSA-N |
| XLogP | -1.53 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|