C9H16N2O3 — CID 107219224
(3-hydroxy-3-methylazetidin-1-yl)-(4-hydroxypyrrolidin-2-yl)methanone (PubChem CID 107219224) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (3-hydroxy-3-methylazetidin-1-yl)-(4-hydroxypyrrolidin-2-yl)methanone.
| Compound Name | (3-hydroxy-3-methylazetidin-1-yl)-(4-hydroxypyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 107219224 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (3-hydroxy-3-methylazetidin-1-yl)-(4-hydroxypyrrolidin-2-yl)methanone |
| SMILES | CC1(O)CN(C(=O)C2CC(O)CN2)C1 |
| InChI | InChI=1S/C9H16N2O3/c1-9(14)4-11(5-9)8(13)7-2-6(12)3-10-7/h6-7,10,12,14H,2-5H2,1H3 |
| InChIKey | QSUMBPZHDLOGAK-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |