C28H30Br2O4 — CID 10722130
6,16-bis(bromomethyl)-25-methoxy-4,18,23-trimethyl-8,11,14-trioxatetracyclo[19.3.1.02,7.015,20]pentacosa-1(24),2,4,6,15,17,19,21(25),22-nonaene (PubChem CID 10722130) has the molecular formula C28H30Br2O4 and a molecular weight of 590.35 g/mol. Its IUPAC name is 6,16-bis(bromomethyl)-25-methoxy-4,18,23-trimethyl-8,11,14-trioxatetracyclo[19.3.1.02,7.015,20]pentacosa-1(24),2,4,6,15,17,19,21(25),22-nonaene.
| Compound Name | 6,16-bis(bromomethyl)-25-methoxy-4,18,23-trimethyl-8,11,14-trioxatetracyclo[19.3.1.02,7.015,20]pentacosa-1(24),2,4,6,15,17,19,21(25),22-nonaene |
|---|---|
| PubChem CID | 10722130 |
| Molecular Formula | C28H30Br2O4 |
| Molecular Weight | 590.35 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | 6,16-bis(bromomethyl)-25-methoxy-4,18,23-trimethyl-8,11,14-trioxatetracyclo[19.3.1.02,7.015,20]pentacosa-1(24),2,4,6,15,17,19,21(25),22-nonaene |
| SMILES | COc1c2cc(C)cc1-c1cc(C)cc(CBr)c1OCCOCCOc1c(CBr)cc(C)cc1-2 |
| InChI | InChI=1S/C28H30Br2O4/c1-17-9-20(15-29)26-22(11-17)24-13-19(3)14-25(28(24)31-4)23-12-18(2)10-21(16-30)27(23)34-8-6-32-5-7-33-26/h9-14H,5-8,15-16H2,1-4H3 |
| InChIKey | BBLQTXNWMCCSRO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.35 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|