About 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide
5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide (PubChem CID 107221914) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide |
| PubChem CID | 107221914 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide |
| SMILES | NCC1CCC(C(=O)N[C@@H]2CCCC[C@H]2O)O1 |
| InChI | InChI=1S/C12H22N2O3/c13-7-8-5-6-11(17-8)12(16)14-9-3-1-2-4-10(9)15/h8-11,15H,1-7,13H2,(H,14,16)/t8?,9-,10-,11?/m1/s1 |
| InChIKey | XIHAGDFUKGTOQQ-WYNUPADASA-N |
| XLogP | -0.09 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide?
The IUPAC name of 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide (CID 107221914) is 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide.
What is the SMILES notation for 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide?
The canonical SMILES for 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide is NCC1CCC(C(=O)N[C@@H]2CCCC[C@H]2O)O1.
What is the InChIKey of 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide?
The InChIKey is XIHAGDFUKGTOQQ-WYNUPADASA-N. The full InChI is InChI=1S/C12H22N2O3/c13-7-8-5-6-11(17-8)12(16)14-9-3-1-2-4-10(9)15/h8-11,15H,1-7,13H2,(H,14,16)/t8?,9-,10-,11?/m1/s1.
What are the key properties of 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide?
5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide has a molecular weight of 242.32 g/mol, XLogP of -0.09, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]oxolane-2-carboxamide is sourced from PubChem (CID 107221914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).