C9H16N2O5 — CID 107222740
methyl 3-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 107222740) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is methyl 3-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107222740 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl 3-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)C1(N)CCOC1 |
| InChI | InChI=1S/C9H16N2O5/c1-15-7(13)6(12)4-11-8(14)9(10)2-3-16-5-9/h6,12H,2-5,10H2,1H3,(H,11,14) |
| InChIKey | QWOKATQHSPQSHO-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |