C14H30N4O2 — CID 107223256
N'-hydroxy-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylpentanimidamide (PubChem CID 107223256) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is N'-hydroxy-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylpentanimidamide.
| Compound Name | N'-hydroxy-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 107223256 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N'-hydroxy-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCN1CCCN(CCO)CC1)C(N)=NO |
| InChI | InChI=1S/C14H30N4O2/c1-14(2,13(15)16-20)5-3-6-17-7-4-8-18(10-9-17)11-12-19/h19-20H,3-12H2,1-2H3,(H2,15,16) |
| InChIKey | YMQXWVIHWVNPON-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|