C14H21FN4O — CID 107223288
2-fluoro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenecarboximidamide (PubChem CID 107223288) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-fluoro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenecarboximidamide.
| Compound Name | 2-fluoro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107223288 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-fluoro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C14H21FN4O/c15-11-3-1-4-12(13(11)14(16)17)19-6-2-5-18(7-8-19)9-10-20/h1,3-4,20H,2,5-10H2,(H3,16,17) |
| InChIKey | SHFOFOIOQAZIGH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|