C11H24N4O — CID 107223305
3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-methylpropanimidamide (PubChem CID 107223305) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-methylpropanimidamide.
| Compound Name | 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 107223305 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN1CCCN(CCO)CC1 |
| InChI | InChI=1S/C11H24N4O/c1-10(11(12)13)9-15-4-2-3-14(5-6-15)7-8-16/h10,16H,2-9H2,1H3,(H3,12,13) |
| InChIKey | PTPLPMWCDAULDQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|