C15H32N4O — CID 107223309
6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylhexanimidamide (PubChem CID 107223309) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is 6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylhexanimidamide.
| Compound Name | 6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 107223309 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCN1CCCN(CCO)CC1 |
| InChI | InChI=1S/C15H32N4O/c1-15(2,14(16)17)6-3-4-7-18-8-5-9-19(11-10-18)12-13-20/h20H,3-13H2,1-2H3,(H3,16,17) |
| InChIKey | SMYIPZYYALARBG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|