C16H24N2O2 — CID 107223361
1-[2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]phenyl]propan-1-one (PubChem CID 107223361) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]phenyl]propan-1-one.
| Compound Name | 1-[2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 107223361 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccccc1N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C16H24N2O2/c1-2-16(20)14-6-3-4-7-15(14)18-9-5-8-17(10-11-18)12-13-19/h3-4,6-7,19H,2,5,8-13H2,1H3 |
| InChIKey | ANYARDPSQPJLRM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |