C14H16N2O2S — CID 107224289
[(3S)-3-hydroxypiperidin-1-yl]-(3-pyrrol-1-ylthiophen-2-yl)methanone (PubChem CID 107224289) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is [(3S)-3-hydroxypiperidin-1-yl]-(3-pyrrol-1-ylthiophen-2-yl)methanone.
| Compound Name | [(3S)-3-hydroxypiperidin-1-yl]-(3-pyrrol-1-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 107224289 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [(3S)-3-hydroxypiperidin-1-yl]-(3-pyrrol-1-ylthiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1-n1cccc1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C14H16N2O2S/c17-11-4-3-8-16(10-11)14(18)13-12(5-9-19-13)15-6-1-2-7-15/h1-2,5-7,9,11,17H,3-4,8,10H2/t11-/m0/s1 |
| InChIKey | WPIDGJWLKRWNBV-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |