C13H16N2O4 — CID 107224584
[(3S)-3-hydroxypiperidin-1-yl]-(2-methyl-6-nitrophenyl)methanone (PubChem CID 107224584) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(3S)-3-hydroxypiperidin-1-yl]-(2-methyl-6-nitrophenyl)methanone.
| Compound Name | [(3S)-3-hydroxypiperidin-1-yl]-(2-methyl-6-nitrophenyl)methanone |
|---|---|
| PubChem CID | 107224584 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [(3S)-3-hydroxypiperidin-1-yl]-(2-methyl-6-nitrophenyl)methanone |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H16N2O4/c1-9-4-2-6-11(15(18)19)12(9)13(17)14-7-3-5-10(16)8-14/h2,4,6,10,16H,3,5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | DTFMACPLVRVPOO-JTQLQIEISA-N |
| XLogP | 1.50 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|