About (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide
(3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide (PubChem CID 107224960) has the molecular formula C8H13F3N2O2
and a molecular weight of 226.20 g/mol. Its IUPAC name is (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
| PubChem CID | 107224960 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C8H13F3N2O2/c9-8(10,11)5-12-7(15)13-3-1-2-6(14)4-13/h6,14H,1-5H2,(H,12,15)/t6-/m0/s1 |
| InChIKey | LSLNDXABKWNKDA-LURJTMIESA-N |
| XLogP | 0.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide?
The IUPAC name of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide (CID 107224960) is (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide.
What is the SMILES notation for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide?
The canonical SMILES for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide is O=C(NCC(F)(F)F)N1CCC[C@H](O)C1.
What is the InChIKey of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide?
The InChIKey is LSLNDXABKWNKDA-LURJTMIESA-N. The full InChI is InChI=1S/C8H13F3N2O2/c9-8(10,11)5-12-7(15)13-3-1-2-6(14)4-13/h6,14H,1-5H2,(H,12,15)/t6-/m0/s1.
What are the key properties of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide?
(3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide has a molecular weight of 226.20 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide is sourced from PubChem (CID 107224960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).