C13H15F3N2O3 — CID 107224975
(3S)-3-hydroxy-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 107224975) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is (3S)-3-hydroxy-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-hydroxy-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 107224975 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (3S)-3-hydroxy-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)21-11-5-3-9(4-6-11)17-12(20)18-7-1-2-10(19)8-18/h3-6,10,19H,1-2,7-8H2,(H,17,20)/t10-/m0/s1 |
| InChIKey | SUHIIJHBBXCIDI-JTQLQIEISA-N |
| XLogP | 2.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |