C12H15F2NO — CID 107225646
(3S)-1-[(3,5-difluorophenyl)methyl]piperidin-3-ol (PubChem CID 107225646) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (3S)-1-[(3,5-difluorophenyl)methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(3,5-difluorophenyl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 107225646 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3S)-1-[(3,5-difluorophenyl)methyl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN(Cc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C12H15F2NO/c13-10-4-9(5-11(14)6-10)7-15-3-1-2-12(16)8-15/h4-6,12,16H,1-3,7-8H2/t12-/m0/s1 |
| InChIKey | MRJYIXZPBNGKLO-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |