C36H37F3O6 — CID 10722567
(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2,2,2-trifluoroethoxy)oxane (PubChem CID 10722567) has the molecular formula C36H37F3O6 and a molecular weight of 622.68 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2,2,2-trifluoroethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2,2,2-trifluoroethoxy)oxane |
|---|---|
| PubChem CID | 10722567 |
| Molecular Formula | C36H37F3O6 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2,2,2-trifluoroethoxy)oxane |
| SMILES | FC(F)(F)CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H37F3O6/c37-36(38,39)26-44-35-34(43-24-30-19-11-4-12-20-30)33(42-23-29-17-9-3-10-18-29)32(41-22-28-15-7-2-8-16-28)31(45-35)25-40-21-27-13-5-1-6-14-27/h1-20,31-35H,21-26H2/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | HKEHLFAPILAUPO-KJQSSVQNSA-N |
| XLogP | 7.26 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |