C33H39NO11 — CID 10722613
[(1S,2S,5S,6R,7R,9S,10S,18R)-5,9,18-triacetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate (PubChem CID 10722613) has the molecular formula C33H39NO11 and a molecular weight of 625.67 g/mol. Its IUPAC name is [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9,18-triacetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate.
| Compound Name | [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9,18-triacetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate |
|---|---|
| PubChem CID | 10722613 |
| Molecular Formula | C33H39NO11 |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9,18-triacetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@@H]2C[C@H](OC(C)=O)[C@@]3(C)Oc4cc(-c5cccnc5)oc(=O)c4[C@H](OC(C)=O)[C@@H]3[C@@]2(C)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H39NO11/c1-17(35)40-16-32(6)24-14-26(42-19(3)37)33(7)29(31(24,5)11-10-25(32)41-18(2)36)28(43-20(4)38)27-23(45-33)13-22(44-30(27)39)21-9-8-12-34-15-21/h8-9,12-13,15,24-26,28-29H,10-11,14,16H2,1-7H3/t24-,25+,26+,28+,29-,31+,32+,33-/m1/s1 |
| InChIKey | YFPHVKOIVCGPQD-YIGCTRRJSA-N |
| XLogP | 4.33 |
| TPSA | 157.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|