C11H18N2O2 — CID 107226246
(3S)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-3-ol (PubChem CID 107226246) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (3S)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 107226246 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3S)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-3-ol |
| SMILES | Cc1nc(CN2CCC[C@H](O)C2)oc1C |
| InChI | InChI=1S/C11H18N2O2/c1-8-9(2)15-11(12-8)7-13-5-3-4-10(14)6-13/h10,14H,3-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | LQQVESCIIRAFGM-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |