C14H19BrN2O2S — CID 107226663
(4-bromo-2-sulfanylphenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 107226663) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is (4-bromo-2-sulfanylphenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-bromo-2-sulfanylphenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 107226663 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (4-bromo-2-sulfanylphenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1S)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C14H19BrN2O2S/c15-11-2-3-12(13(20)10-11)14(19)17-5-1-4-16(6-7-17)8-9-18/h2-3,10,18,20H,1,4-9H2 |
| InChIKey | NWTDCSPZLSEZGE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|