C31H53N4O8P — CID 10722796
[4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2R)-1-(dihexylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 10722796) has the molecular formula C31H53N4O8P and a molecular weight of 640.76 g/mol. Its IUPAC name is [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2R)-1-(dihexylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2R)-1-(dihexylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10722796 |
| Molecular Formula | C31H53N4O8P |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2R)-1-(dihexylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CCCCCCN(CCCCCC)C(=O)[C@@H](C)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(C)=O)C(C)C |
| InChI | InChI=1S/C31H53N4O8P/c1-7-9-11-13-19-35(20-14-12-10-8-2)31(39)23(5)32-30(38)28(22(3)4)34-29(37)27(33-24(6)36)21-25-15-17-26(18-16-25)43-44(40,41)42/h15-18,22-23,27-28H,7-14,19-21H2,1-6H3,(H,32,38)(H,33,36)(H,34,37)(H2,40,41,42)/t23-,27+,28+/m1/s1 |
| InChIKey | WKENBZRMFRFVRD-UIUQJESISA-N |
| XLogP | 3.84 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|