C17H29N3O — CID 107228161
2-[1-[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]piperidin-3-yl]ethanol (PubChem CID 107228161) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[1-[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]piperidin-3-yl]ethanol.
| Compound Name | 2-[1-[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 107228161 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-[1-[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]piperidin-3-yl]ethanol |
| SMILES | Cc1cc(CNC(C)C)cnc1N1CCCC(CCO)C1 |
| InChI | InChI=1S/C17H29N3O/c1-13(2)18-10-16-9-14(3)17(19-11-16)20-7-4-5-15(12-20)6-8-21/h9,11,13,15,18,21H,4-8,10,12H2,1-3H3 |
| InChIKey | DSWDCBLANJMLKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |