About [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol
[4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol (PubChem CID 107230009) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol |
| PubChem CID | 107230009 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol |
| SMILES | CCn1nc(C)c(C(C)NCc2ccc(CO)cc2)c1C |
| InChI | InChI=1S/C17H25N3O/c1-5-20-14(4)17(13(3)19-20)12(2)18-10-15-6-8-16(11-21)9-7-15/h6-9,12,18,21H,5,10-11H2,1-4H3 |
| InChIKey | VGHYRWVILRDVIC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol?
The IUPAC name of [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol (CID 107230009) is [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol?
The canonical SMILES for [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol is CCn1nc(C)c(C(C)NCc2ccc(CO)cc2)c1C.
What is the InChIKey of [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol?
The InChIKey is VGHYRWVILRDVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-5-20-14(4)17(13(3)19-20)12(2)18-10-15-6-8-16(11-21)9-7-15/h6-9,12,18,21H,5,10-11H2,1-4H3.
What are the key properties of [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol?
[4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol has a molecular weight of 287.41 g/mol, XLogP of 2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]phenyl]methanol is sourced from PubChem (CID 107230009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).