C16H17NO2 — CID 107231351
N-[[4-(hydroxymethyl)phenyl]methyl]-3-methylbenzamide (PubChem CID 107231351) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[[4-(hydroxymethyl)phenyl]methyl]-3-methylbenzamide.
| Compound Name | N-[[4-(hydroxymethyl)phenyl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 107231351 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[[4-(hydroxymethyl)phenyl]methyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCc2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C16H17NO2/c1-12-3-2-4-15(9-12)16(19)17-10-13-5-7-14(11-18)8-6-13/h2-9,18H,10-11H2,1H3,(H,17,19) |
| InChIKey | XRTGBSKPYXEAJN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |