C19H18N2O5 — CID 1072336
(5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-methyl-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 1072336) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-methyl-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-methyl-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1072336 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-methyl-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(C)[C@H]2c2cccnc2)cc1OC |
| InChI | InChI=1S/C19H18N2O5/c1-21-16(12-5-4-8-20-10-12)15(18(23)19(21)24)17(22)11-6-7-13(25-2)14(9-11)26-3/h4-10,16,22H,1-3H3/t16-/m0/s1 |
| InChIKey | WBBIQDMRGADXSI-INIZCTEOSA-N |
| XLogP | 2.15 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|