C16H19N3 — CID 107234255
N-[(4-pyrazol-1-ylphenyl)methyl]hex-1-yn-3-amine (PubChem CID 107234255) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[(4-pyrazol-1-ylphenyl)methyl]hex-1-yn-3-amine.
| Compound Name | N-[(4-pyrazol-1-ylphenyl)methyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 107234255 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[(4-pyrazol-1-ylphenyl)methyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C16H19N3/c1-3-6-15(4-2)17-13-14-7-9-16(10-8-14)19-12-5-11-18-19/h2,5,7-12,15,17H,3,6,13H2,1H3 |
| InChIKey | FGHQGRSZRKBOKC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|