C17H10F17N3O6S — CID 10723468
2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxyacetamide (PubChem CID 10723468) has the molecular formula C17H10F17N3O6S and a molecular weight of 707.31 g/mol. Its IUPAC name is 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10723468 |
| Molecular Formula | C17H10F17N3O6S |
| Molecular Weight | 707.31 g/mol |
| Exact Mass | 707.00 |
| IUPAC Name | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxyacetamide |
| SMILES | O=C(CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NO |
| InChI | InChI=1S/C17H10F17N3O6S/c18-10(19,12(22,23)14(26,27)16(30,31)32)11(20,21)13(24,25)15(28,29)17(33,34)44(42,43)36(6-9(38)35-39)5-7-1-3-8(4-2-7)37(40)41/h1-4,39H,5-6H2,(H,35,38) |
| InChIKey | GHHVNOZFZMDYFQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|