C15H22N2S — CID 107236224
N-[(1-methylindol-3-yl)methyl]-4-methylsulfanylbutan-1-amine (PubChem CID 107236224) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 107236224 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCNCc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C15H22N2S/c1-17-12-13(11-16-9-5-6-10-18-2)14-7-3-4-8-15(14)17/h3-4,7-8,12,16H,5-6,9-11H2,1-2H3 |
| InChIKey | GQVDABZFIBGCNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|