C17H24N2O2 — CID 107236506
3-[(1,3-dimethylindol-2-yl)methyl-ethylamino]butanoic acid (PubChem CID 107236506) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[(1,3-dimethylindol-2-yl)methyl-ethylamino]butanoic acid.
| Compound Name | 3-[(1,3-dimethylindol-2-yl)methyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 107236506 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-[(1,3-dimethylindol-2-yl)methyl-ethylamino]butanoic acid |
| SMILES | CCN(Cc1c(C)c2ccccc2n1C)C(C)CC(=O)O |
| InChI | InChI=1S/C17H24N2O2/c1-5-19(12(2)10-17(20)21)11-16-13(3)14-8-6-7-9-15(14)18(16)4/h6-9,12H,5,10-11H2,1-4H3,(H,20,21) |
| InChIKey | BVXIZCPBLAMGFG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|