C15H21N3O2 — CID 107236890
tert-butyl N-[(1-methylindol-3-yl)methylamino]carbamate (PubChem CID 107236890) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[(1-methylindol-3-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(1-methylindol-3-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107236890 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl N-[(1-methylindol-3-yl)methylamino]carbamate |
| SMILES | Cn1cc(CNNC(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,3)20-14(19)17-16-9-11-10-18(4)13-8-6-5-7-12(11)13/h5-8,10,16H,9H2,1-4H3,(H,17,19) |
| InChIKey | YQWMVPTYGPSUIW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|