C15H28N2O2 — CID 107237375
tert-butyl N-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]carbamate (PubChem CID 107237375) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is tert-butyl N-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]carbamate |
|---|---|
| PubChem CID | 107237375 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl N-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C15H28N2O2/c1-13(2,3)19-12(18)17-16-11-14(4,5)10-7-8-15(11,6)9-10/h10-11,16H,7-9H2,1-6H3,(H,17,18)/t10-,11?,15+/m0/s1 |
| InChIKey | KWMAYBLSFDPVJE-ZYTVVRLJSA-N |
| XLogP | 3.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|