C35H53BrO11Si — CID 10723821
tetramethyl (2E,7E,12E)-1-bromo-14-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]tetradeca-2,7,12-triene-4,4,9,9-tetracarboxylate (PubChem CID 10723821) has the molecular formula C35H53BrO11Si and a molecular weight of 757.79 g/mol. Its IUPAC name is tetramethyl (2E,7E,12E)-1-bromo-14-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]tetradeca-2,7,12-triene-4,4,9,9-tetracarboxylate.
| Compound Name | tetramethyl (2E,7E,12E)-1-bromo-14-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]tetradeca-2,7,12-triene-4,4,9,9-tetracarboxylate |
|---|---|
| PubChem CID | 10723821 |
| Molecular Formula | C35H53BrO11Si |
| Molecular Weight | 757.79 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | tetramethyl (2E,7E,12E)-1-bromo-14-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]tetradeca-2,7,12-triene-4,4,9,9-tetracarboxylate |
| SMILES | C=CC1(O[Si](C)(C)C(C)(C)C)CC1(C/C=C/CC(C/C=C/CC(C/C=C/CBr)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C35H53BrO11Si/c1-12-35(47-48(10,11)31(2,3)4)25-34(35,30(41)46-9)23-16-15-21-32(26(37)42-5,27(38)43-6)19-13-14-20-33(28(39)44-7,29(40)45-8)22-17-18-24-36/h12-18H,1,19-25H2,2-11H3/b14-13+,16-15+,18-17+ |
| InChIKey | IHGAXZHBSOLLHM-JYASHPIESA-N |
| XLogP | 6.17 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|