C16H24N4O2 — CID 107239010
tert-butyl N-[3-[(5-cyano-1-methylpyrrol-3-yl)methylamino]cyclobutyl]carbamate (PubChem CID 107239010) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-cyano-1-methylpyrrol-3-yl)methylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-cyano-1-methylpyrrol-3-yl)methylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107239010 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | tert-butyl N-[3-[(5-cyano-1-methylpyrrol-3-yl)methylamino]cyclobutyl]carbamate |
| SMILES | Cn1cc(CNC2CC(NC(=O)OC(C)(C)C)C2)cc1C#N |
| InChI | InChI=1S/C16H24N4O2/c1-16(2,3)22-15(21)19-13-6-12(7-13)18-9-11-5-14(8-17)20(4)10-11/h5,10,12-13,18H,6-7,9H2,1-4H3,(H,19,21) |
| InChIKey | PSSDJVZKTVHKQM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |